C21H14ClF3N2S — CID 146049709
4-(2-chlorophenyl)-5-methyl-2-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1H-imidazole (PubChem CID 146049709) has the molecular formula C21H14ClF3N2S and a molecular weight of 418.87 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-methyl-2-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1H-imidazole.
| Compound Name | 4-(2-chlorophenyl)-5-methyl-2-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 146049709 |
| Molecular Formula | C21H14ClF3N2S |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 4-(2-chlorophenyl)-5-methyl-2-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1H-imidazole |
| SMILES | Cc1[nH]c(-c2ccc(-c3ccc(C(F)(F)F)cc3)s2)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C21H14ClF3N2S/c1-12-19(15-4-2-3-5-16(15)22)27-20(26-12)18-11-10-17(28-18)13-6-8-14(9-7-13)21(23,24)25/h2-11H,1H3,(H,26,27) |
| InChIKey | IUIXGULIWYVTPE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |