C6H10N2 — CID 143380127
N'-[(3Z)-penta-1,3-dien-3-yl]methanimidamide (PubChem CID 143380127) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is N'-[(3Z)-penta-1,3-dien-3-yl]methanimidamide.
| Compound Name | N'-[(3Z)-penta-1,3-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 143380127 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | N'-[(3Z)-penta-1,3-dien-3-yl]methanimidamide |
| SMILES | C=CC(=C/C)/N=C/N |
| InChI | InChI=1S/C6H10N2/c1-3-6(4-2)8-5-7/h3-5H,1H2,2H3,(H2,7,8)/b6-4- |
| InChIKey | IXDMEPUOWPSWQE-XQRVVYSFSA-N |
| XLogP | 1.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|