C6H11N3 — CID 58082055
2-[(2E)-penta-2,4-dien-2-yl]guanidine (PubChem CID 58082055) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-[(2E)-penta-2,4-dien-2-yl]guanidine.
| Compound Name | 2-[(2E)-penta-2,4-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 58082055 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-[(2E)-penta-2,4-dien-2-yl]guanidine |
| SMILES | C=C/C=C(\C)N=C(N)N |
| InChI | InChI=1S/C6H11N3/c1-3-4-5(2)9-6(7)8/h3-4H,1H2,2H3,(H4,7,8,9)/b5-4+ |
| InChIKey | OCOUINPVHFPGEN-SNAWJCMRSA-N |
| XLogP | 0.35 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|