C18H25NO — CID 143380562
6-heptan-4-yloxy-7,8-dimethylisoquinoline (PubChem CID 143380562) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 6-heptan-4-yloxy-7,8-dimethylisoquinoline.
| Compound Name | 6-heptan-4-yloxy-7,8-dimethylisoquinoline |
|---|---|
| PubChem CID | 143380562 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 6-heptan-4-yloxy-7,8-dimethylisoquinoline |
| SMILES | CCCC(CCC)Oc1cc2ccncc2c(C)c1C |
| InChI | InChI=1S/C18H25NO/c1-5-7-16(8-6-2)20-18-11-15-9-10-19-12-17(15)13(3)14(18)4/h9-12,16H,5-8H2,1-4H3 |
| InChIKey | BNGOVNYBJHUPNH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |