C17H24F2O — CID 143381560
[(E)-5-ethyl-2,2-difluoronon-3-enoxy]benzene (PubChem CID 143381560) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is [(E)-5-ethyl-2,2-difluoronon-3-enoxy]benzene.
| Compound Name | [(E)-5-ethyl-2,2-difluoronon-3-enoxy]benzene |
|---|---|
| PubChem CID | 143381560 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [(E)-5-ethyl-2,2-difluoronon-3-enoxy]benzene |
| SMILES | CCCCC(/C=C/C(F)(F)COc1ccccc1)CC |
| InChI | InChI=1S/C17H24F2O/c1-3-5-9-15(4-2)12-13-17(18,19)14-20-16-10-7-6-8-11-16/h6-8,10-13,15H,3-5,9,14H2,1-2H3/b13-12+ |
| InChIKey | IETMZRPHGUHKSQ-OUKQBFOZSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|