C31H48F2N2O7 — CID 143381465
[(E)-5-ethyl-2,2-difluorooct-3-enoxy]benzene;4-nitrooxybutyl 2-[[(Z)-oct-5-enoyl]amino]propanoate (PubChem CID 143381465) has the molecular formula C31H48F2N2O7 and a molecular weight of 598.73 g/mol. Its IUPAC name is [(E)-5-ethyl-2,2-difluorooct-3-enoxy]benzene;4-nitrooxybutyl 2-[[(Z)-oct-5-enoyl]amino]propanoate.
| Compound Name | [(E)-5-ethyl-2,2-difluorooct-3-enoxy]benzene;4-nitrooxybutyl 2-[[(Z)-oct-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 143381465 |
| Molecular Formula | C31H48F2N2O7 |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [(E)-5-ethyl-2,2-difluorooct-3-enoxy]benzene;4-nitrooxybutyl 2-[[(Z)-oct-5-enoyl]amino]propanoate |
| SMILES | CC/C=C\CCCC(=O)NC(C)C(=O)OCCCCO[N+](=O)[O-].CCCC(/C=C/C(F)(F)COc1ccccc1)CC |
| InChI | InChI=1S/C16H22F2O.C15H26N2O6/c1-3-8-14(4-2)11-12-16(17,18)13-19-15-9-6-5-7-10-15;1-3-4-5-6-7-10-14(18)16-13(2)15(19)22-11-8-9-12-23-17(20)21/h5-7,9-12,14H,3-4,8,13H2,1-2H3;4-5,13H,3,6-12H2,1-2H3,(H,16,18)/b12-11+;5-4- |
| InChIKey | LRAKBKUYBRUFFQ-NAGYSREISA-N |
| XLogP | 7.24 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|