C33H56N2O6 — CID 143889007
[(E)-6-ethylnon-4-enyl]benzene;(Z)-N-ethyloct-5-enamide;5-nitrooxyhexanoic acid (PubChem CID 143889007) has the molecular formula C33H56N2O6 and a molecular weight of 576.82 g/mol. Its IUPAC name is [(E)-6-ethylnon-4-enyl]benzene;(Z)-N-ethyloct-5-enamide;5-nitrooxyhexanoic acid.
| Compound Name | [(E)-6-ethylnon-4-enyl]benzene;(Z)-N-ethyloct-5-enamide;5-nitrooxyhexanoic acid |
|---|---|
| PubChem CID | 143889007 |
| Molecular Formula | C33H56N2O6 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.41 |
| IUPAC Name | [(E)-6-ethylnon-4-enyl]benzene;(Z)-N-ethyloct-5-enamide;5-nitrooxyhexanoic acid |
| SMILES | CC(CCCC(=O)O)O[N+](=O)[O-].CC/C=C\CCCC(=O)NCC.CCCC(/C=C/CCCc1ccccc1)CC |
| InChI | InChI=1S/C17H26.C10H19NO.C6H11NO5/c1-3-11-16(4-2)12-7-5-8-13-17-14-9-6-10-15-17;1-3-5-6-7-8-9-10(12)11-4-2;1-5(12-7(10)11)3-2-4-6(8)9/h6-7,9-10,12,14-16H,3-5,8,11,13H2,1-2H3;5-6H,3-4,7-9H2,1-2H3,(H,11,12);5H,2-4H2,1H3,(H,8,9)/b12-7+;6-5-; |
| InChIKey | AHMPVLRJWFBNOJ-SKVMQRLHSA-N |
| XLogP | 8.49 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|