C14H16O3S2 — CID 143385446
(3E,5Z)-6-methylsulfanyl-6-(3-methylsulfonylphenyl)hexa-3,5-dien-2-one (PubChem CID 143385446) has the molecular formula C14H16O3S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3E,5Z)-6-methylsulfanyl-6-(3-methylsulfonylphenyl)hexa-3,5-dien-2-one.
| Compound Name | (3E,5Z)-6-methylsulfanyl-6-(3-methylsulfonylphenyl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 143385446 |
| Molecular Formula | C14H16O3S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (3E,5Z)-6-methylsulfanyl-6-(3-methylsulfonylphenyl)hexa-3,5-dien-2-one |
| SMILES | CS/C(=C\C=C\C(C)=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H16O3S2/c1-11(15)6-4-9-14(18-2)12-7-5-8-13(10-12)19(3,16)17/h4-10H,1-3H3/b6-4+,14-9- |
| InChIKey | PKZWYGVLIKWVAI-YFZWXOIXSA-N |
| XLogP | 2.94 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|