C12H27NO — CID 143386956
(2Z,4E)-6-amino-3-methylhexa-2,4-dien-2-ol;ethane;propane (PubChem CID 143386956) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is (2Z,4E)-6-amino-3-methylhexa-2,4-dien-2-ol;ethane;propane.
| Compound Name | (2Z,4E)-6-amino-3-methylhexa-2,4-dien-2-ol;ethane;propane |
|---|---|
| PubChem CID | 143386956 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (2Z,4E)-6-amino-3-methylhexa-2,4-dien-2-ol;ethane;propane |
| SMILES | C/C(O)=C(C)/C=C/CN.CC.CCC |
| InChI | InChI=1S/C7H13NO.C3H8.C2H6/c1-6(7(2)9)4-3-5-8;1-3-2;1-2/h3-4,9H,5,8H2,1-2H3;3H2,1-2H3;1-2H3/b4-3+,7-6-;; |
| InChIKey | MLNSPZOKPOLYDS-UGIDVWHNSA-N |
| XLogP | 3.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|