C11H25NO — CID 143077499
2-aminoethanol;ethane;(2Z,4Z)-3-methylhexa-2,4-diene (PubChem CID 143077499) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-aminoethanol;ethane;(2Z,4Z)-3-methylhexa-2,4-diene.
| Compound Name | 2-aminoethanol;ethane;(2Z,4Z)-3-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 143077499 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 2-aminoethanol;ethane;(2Z,4Z)-3-methylhexa-2,4-diene |
| SMILES | C/C=C\C(C)=C/C.CC.NCCO |
| InChI | InChI=1S/C7H12.C2H7NO.C2H6/c1-4-6-7(3)5-2;3-1-2-4;1-2/h4-6H,1-3H3;4H,1-3H2;1-2H3/b6-4-,7-5-;; |
| InChIKey | BHMFGZPXPLRDJG-RVMHNBBFSA-N |
| XLogP | 2.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|