C13H25NO — CID 143110118
(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;methanol;prop-1-ene (PubChem CID 143110118) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;methanol;prop-1-ene.
| Compound Name | (3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;methanol;prop-1-ene |
|---|---|
| PubChem CID | 143110118 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;methanol;prop-1-ene |
| SMILES | C=C/C=C(\C=C)C(C)CN.C=CC.CO |
| InChI | InChI=1S/C9H15N.C3H6.CH4O/c1-4-6-9(5-2)8(3)7-10;1-3-2;1-2/h4-6,8H,1-2,7,10H2,3H3;3H,1H2,2H3;2H,1H3/b9-6+;; |
| InChIKey | VPRYFCXXDHCIJV-SWSRPJROSA-N |
| XLogP | 2.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|