C11H21N — CID 143180427
ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine (PubChem CID 143180427) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine.
| Compound Name | ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143180427 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(\C=C)C(C)CN.CC |
| InChI | InChI=1S/C9H15N.C2H6/c1-4-6-9(5-2)8(3)7-10;1-2/h4-6,8H,1-2,7,10H2,3H3;1-2H3/b9-6+; |
| InChIKey | RXXMTYSLUZETOK-MLBSPLJJSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|