About 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide
2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide (PubChem CID 86574471) has the molecular formula C12H20ClN2Ru
and a molecular weight of 328.83 g/mol. Its IUPAC name is 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide.
Molecular Properties
| Compound Name | 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide |
| PubChem CID | 86574471 |
| Molecular Formula | C12H20ClN2Ru |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide |
| SMILES | Cc1[c-]cc(C(C)C)cc1.Cl[Ru+2].[NH-]CCN |
| InChI | InChI=1S/C10H13.C2H7N2.ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;3-1-2-4;;/h4,6-8H,1-3H3;3H,1-2,4H2;1H;/q2*-1;;+3/p-1 |
| InChIKey | XAPFEBHPRHPOJL-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide?
The IUPAC name of 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide (CID 86574471) is 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide.
What is the SMILES notation for 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide?
The canonical SMILES for 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide is Cc1[c-]cc(C(C)C)cc1.Cl[Ru+2].[NH-]CCN.
What is the InChIKey of 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide?
The InChIKey is XAPFEBHPRHPOJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13.C2H7N2.ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;3-1-2-4;;/h4,6-8H,1-3H3;3H,1-2,4H2;1H;/q2*-1;;+3/p-1.
What are the key properties of 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide?
2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide has a molecular weight of 328.83 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene-6-ide is sourced from PubChem (CID 86574471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).