C12H21N — CID 143110146
(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;prop-1-ene (PubChem CID 143110146) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;prop-1-ene.
| Compound Name | (3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 143110146 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;prop-1-ene |
| SMILES | C=C/C=C(\C=C)C(C)CN.C=CC |
| InChI | InChI=1S/C9H15N.C3H6/c1-4-6-9(5-2)8(3)7-10;1-3-2/h4-6,8H,1-2,7,10H2,3H3;3H,1H2,2H3/b9-6+; |
| InChIKey | MHXZJGIZWGBHGA-MLBSPLJJSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|