C10H17N — CID 142097121
(3E)-2-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine (PubChem CID 142097121) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (3E)-2-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine.
| Compound Name | (3E)-2-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142097121 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3E)-2-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(\C=C/C)C(C)CN |
| InChI | InChI=1S/C10H17N/c1-4-6-10(7-5-2)9(3)8-11/h4-7,9H,1,8,11H2,2-3H3/b7-5-,10-6+ |
| InChIKey | MUGAWDGEDVXSBF-ZPRNNRRZSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|