C14H29N — CID 143110013
ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;propane (PubChem CID 143110013) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;propane.
| Compound Name | ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;propane |
|---|---|
| PubChem CID | 143110013 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;(3E)-3-ethenyl-2-methylhexa-3,5-dien-1-amine;propane |
| SMILES | C=C/C=C(\C=C)C(C)CN.CC.CCC |
| InChI | InChI=1S/C9H15N.C3H8.C2H6/c1-4-6-9(5-2)8(3)7-10;1-3-2;1-2/h4-6,8H,1-2,7,10H2,3H3;3H2,1-2H3;1-2H3/b9-6+;; |
| InChIKey | QSFDQJAHZKXZEZ-SWSRPJROSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|