C10H14N2 — CID 143387476
(7Z,9Z)-1,2,3,4,5,6-hexahydrocycloocta[c]pyridazine (PubChem CID 143387476) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (7Z,9Z)-1,2,3,4,5,6-hexahydrocycloocta[c]pyridazine.
| Compound Name | (7Z,9Z)-1,2,3,4,5,6-hexahydrocycloocta[c]pyridazine |
|---|---|
| PubChem CID | 143387476 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (7Z,9Z)-1,2,3,4,5,6-hexahydrocycloocta[c]pyridazine |
| SMILES | C1=C\CCC2=C(\C=C/1)NNCC2 |
| InChI | InChI=1S/C10H14N2/c1-2-4-6-10-9(5-3-1)7-8-11-12-10/h1-2,4,6,11-12H,3,5,7-8H2/b2-1-,6-4- |
| InChIKey | WUTXIQAXCWCCTR-FIGGJLSXSA-N |
| XLogP | 1.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |