C25H31Cl3F3N4O+ — CID 143395117
[[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane (PubChem CID 143395117) has the molecular formula C25H31Cl3F3N4O+ and a molecular weight of 566.90 g/mol. Its IUPAC name is [[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane.
| Compound Name | [[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane |
|---|---|
| PubChem CID | 143395117 |
| Molecular Formula | C25H31Cl3F3N4O+ |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | [[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane |
| SMILES | CC.CCCCC[NH+](C)NC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1C(F)(F)F |
| InChI | InChI=1S/C23H24Cl3F3N4O.C2H6/c1-3-4-5-12-32(2)31-22(34)20-19(23(27,28)29)21(14-6-8-15(24)9-7-14)33(30-20)18-11-10-16(25)13-17(18)26;1-2/h6-11,13,19,21H,3-5,12H2,1-2H3,(H,31,34);1-2H3/p+1 |
| InChIKey | AUSZDMPLZSIHKC-UHFFFAOYSA-O |
| XLogP | 6.50 |
| TPSA | 49.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|