C27H39Cl2N4O+ — CID 143395085
[[2-(2,4-dichlorophenyl)-4,4-dimethyl-3-(4-methylphenyl)-3H-pyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane (PubChem CID 143395085) has the molecular formula C27H39Cl2N4O+ and a molecular weight of 506.54 g/mol. Its IUPAC name is [[2-(2,4-dichlorophenyl)-4,4-dimethyl-3-(4-methylphenyl)-3H-pyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane.
| Compound Name | [[2-(2,4-dichlorophenyl)-4,4-dimethyl-3-(4-methylphenyl)-3H-pyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane |
|---|---|
| PubChem CID | 143395085 |
| Molecular Formula | C27H39Cl2N4O+ |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | [[2-(2,4-dichlorophenyl)-4,4-dimethyl-3-(4-methylphenyl)-3H-pyrazole-5-carbonyl]amino]-methyl-pentylazanium;ethane |
| SMILES | CC.CCCCC[NH+](C)NC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(C)cc2)C1(C)C |
| InChI | InChI=1S/C25H32Cl2N4O.C2H6/c1-6-7-8-15-30(5)29-24(32)22-25(3,4)23(18-11-9-17(2)10-12-18)31(28-22)21-14-13-19(26)16-20(21)27;1-2/h9-14,16,23H,6-8,15H2,1-5H3,(H,29,32);1-2H3/p+1 |
| InChIKey | CBEVPUASWOVFDU-UHFFFAOYSA-O |
| XLogP | 6.01 |
| TPSA | 49.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|