C20H29N3 — CID 143396204
(3E,5Z,8Z)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-8-piperidin-4-yl-2,7-dihydro-1H-1,3-diazonine (PubChem CID 143396204) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is (3E,5Z,8Z)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-8-piperidin-4-yl-2,7-dihydro-1H-1,3-diazonine.
| Compound Name | (3E,5Z,8Z)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-8-piperidin-4-yl-2,7-dihydro-1H-1,3-diazonine |
|---|---|
| PubChem CID | 143396204 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | (3E,5Z,8Z)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-8-piperidin-4-yl-2,7-dihydro-1H-1,3-diazonine |
| SMILES | C=CC(=C\C=C/C)/C1=N/CN/C=C(/C2CCNCC2)C(C)/C=C\1 |
| InChI | InChI=1S/C20H29N3/c1-4-6-7-17(5-2)20-9-8-16(3)19(14-22-15-23-20)18-10-12-21-13-11-18/h4-9,14,16,18,21-22H,2,10-13,15H2,1,3H3/b6-4-,9-8-,17-7+,19-14+,23-20+ |
| InChIKey | GAEATZPBOAVGAZ-LYQLACEZSA-N |
| XLogP | 3.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|