C19H22N4O2S — CID 143396550
methyl 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetate;2-methylbenzenethiol (PubChem CID 143396550) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is methyl 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetate;2-methylbenzenethiol.
| Compound Name | methyl 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetate;2-methylbenzenethiol |
|---|---|
| PubChem CID | 143396550 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 2-[[2-(aminomethyl)quinazolin-4-yl]amino]acetate;2-methylbenzenethiol |
| SMILES | COC(=O)CNc1nc(CN)nc2ccccc12.Cc1ccccc1S |
| InChI | InChI=1S/C12H14N4O2.C7H8S/c1-18-11(17)7-14-12-8-4-2-3-5-9(8)15-10(6-13)16-12;1-6-4-2-3-5-7(6)8/h2-5H,6-7,13H2,1H3,(H,14,15,16);2-5,8H,1H3 |
| InChIKey | HGNMIBIITJLLSF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|