C26H33N5O2 — CID 28958060
methyl 4-[[2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate (PubChem CID 28958060) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is methyl 4-[[2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate.
| Compound Name | methyl 4-[[2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 28958060 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | methyl 4-[[2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate |
| SMILES | COC(=O)CCCNc1nc(CN2CCN(c3cccc(C)c3C)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H33N5O2/c1-19-8-6-11-23(20(19)2)31-16-14-30(15-17-31)18-24-28-22-10-5-4-9-21(22)26(29-24)27-13-7-12-25(32)33-3/h4-6,8-11H,7,12-18H2,1-3H3,(H,27,28,29) |
| InChIKey | XYZWCIFVVQYROU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|