C17H21NO4 — CID 143398472
methyl N-[1-(1-formyl-2-oxocyclopentyl)-3-phenylpropyl]carbamate (PubChem CID 143398472) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl N-[1-(1-formyl-2-oxocyclopentyl)-3-phenylpropyl]carbamate.
| Compound Name | methyl N-[1-(1-formyl-2-oxocyclopentyl)-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 143398472 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl N-[1-(1-formyl-2-oxocyclopentyl)-3-phenylpropyl]carbamate |
| SMILES | COC(=O)NC(CCc1ccccc1)C1(C=O)CCCC1=O |
| InChI | InChI=1S/C17H21NO4/c1-22-16(21)18-14(10-9-13-6-3-2-4-7-13)17(12-19)11-5-8-15(17)20/h2-4,6-7,12,14H,5,8-11H2,1H3,(H,18,21) |
| InChIKey | WRAIWLTZTWDHCA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|