C28H53N7O2 — CID 143398672
11-(5,5-dimethylhept-6-yn-3-yl)-3-hydroxy-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3,5,7,9,11,13-hexazatricyclo[7.4.0.02,7]tridecan-8-one;ethane (PubChem CID 143398672) has the molecular formula C28H53N7O2 and a molecular weight of 519.78 g/mol. Its IUPAC name is 11-(5,5-dimethylhept-6-yn-3-yl)-3-hydroxy-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3,5,7,9,11,13-hexazatricyclo[7.4.0.02,7]tridecan-8-one;ethane.
| Compound Name | 11-(5,5-dimethylhept-6-yn-3-yl)-3-hydroxy-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3,5,7,9,11,13-hexazatricyclo[7.4.0.02,7]tridecan-8-one;ethane |
|---|---|
| PubChem CID | 143398672 |
| Molecular Formula | C28H53N7O2 |
| Molecular Weight | 519.78 g/mol |
| Exact Mass | 519.43 |
| IUPAC Name | 11-(5,5-dimethylhept-6-yn-3-yl)-3-hydroxy-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3,5,7,9,11,13-hexazatricyclo[7.4.0.02,7]tridecan-8-one;ethane |
| SMILES | C#CC(C)(C)CC(CC)N1CNC2C3N(O)CN(C4CC(C)(C)N(C)C(C)(C)C4)CN3C(=O)N2C1.CC |
| InChI | InChI=1S/C26H47N7O2.C2H6/c1-10-19(12-24(3,4)11-2)29-15-27-21-22-32(23(34)31(21)16-29)17-30(18-33(22)35)20-13-25(5,6)28(9)26(7,8)14-20;1-2/h2,19-22,27,35H,10,12-18H2,1,3-9H3;1-2H3 |
| InChIKey | ISWIKQXZBGZPEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|