C25H44N8O3S — CID 143193565
3-(1-hydroxy-2,2,6-trimethylpiperidin-4-yl)-9-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 143193565) has the molecular formula C25H44N8O3S and a molecular weight of 536.75 g/mol. Its IUPAC name is 3-(1-hydroxy-2,2,6-trimethylpiperidin-4-yl)-9-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 3-(1-hydroxy-2,2,6-trimethylpiperidin-4-yl)-9-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 143193565 |
| Molecular Formula | C25H44N8O3S |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 3-(1-hydroxy-2,2,6-trimethylpiperidin-4-yl)-9-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | CC1CC(N2CN3C(=O)N4CN(C5CC(C)(C)N(S)C(C)(C)C5)CN5C(=O)N(C2)C3C45)CC(C)(C)N1O |
| InChI | InChI=1S/C25H44N8O3S/c1-16-8-17(9-23(2,3)32(16)36)26-12-28-19-20-30(21(28)34)14-27(15-31(20)22(35)29(19)13-26)18-10-24(4,5)33(37)25(6,7)11-18/h16-20,36-37H,8-15H2,1-7H3 |
| InChIKey | GXOXZDSKPYPWON-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|