C14H26N4 — CID 15691263
(2R,4S,8S,10R)-2,4,8,10-tetramethyl-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane (PubChem CID 15691263) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is (2R,4S,8S,10R)-2,4,8,10-tetramethyl-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane.
| Compound Name | (2R,4S,8S,10R)-2,4,8,10-tetramethyl-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane |
|---|---|
| PubChem CID | 15691263 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | (2R,4S,8S,10R)-2,4,8,10-tetramethyl-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane |
| SMILES | C[C@@H]1C[C@H](C)N2CN3C4C2N1CN4[C@H](C)C[C@@H]3C |
| InChI | InChI=1S/C14H26N4/c1-9-5-10(2)17-8-18-12(4)6-11(3)16-7-15(9)13(17)14(16)18/h9-14H,5-8H2,1-4H3/t9-,10+,11-,12+,13?,14? |
| InChIKey | BYFMUBAGHIFGCH-QHMRNEKISA-N |
| XLogP | 1.15 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |