C7H14N2 — CID 639498
(2S,4R)-2,4,6-trimethyl-1,5-diazabicyclo[3.1.0]hexane (PubChem CID 639498) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (2S,4R)-2,4,6-trimethyl-1,5-diazabicyclo[3.1.0]hexane.
| Compound Name | (2S,4R)-2,4,6-trimethyl-1,5-diazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 639498 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (2S,4R)-2,4,6-trimethyl-1,5-diazabicyclo[3.1.0]hexane |
| SMILES | CC1N2[C@H](C)C[C@H](C)N12 |
| InChI | InChI=1S/C7H14N2/c1-5-4-6(2)9-7(3)8(5)9/h5-7H,4H2,1-3H3/t5-,6+,7?,8?,9? |
| InChIKey | NLMJDJJMLLUEDB-GFQQECDTSA-N |
| XLogP | 1.05 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|