C26H42N4O6 — CID 163804231
1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,5-dioxopyrrolidin-3-yl]pyrrolidine-2,5-dione (PubChem CID 163804231) has the molecular formula C26H42N4O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,5-dioxopyrrolidin-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,5-dioxopyrrolidin-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163804231 |
| Molecular Formula | C26H42N4O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,5-dioxopyrrolidin-3-yl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(N2C(=O)CC(C3CC(=O)N(C4CC(C)(C)N(O)C(C)(C)C4)C3=O)C2=O)CC(C)(C)N1O |
| InChI | InChI=1S/C26H42N4O6/c1-23(2)11-15(12-24(3,4)29(23)35)27-19(31)9-17(21(27)33)18-10-20(32)28(22(18)34)16-13-25(5,6)30(36)26(7,8)14-16/h15-18,35-36H,9-14H2,1-8H3 |
| InChIKey | NHPLWNXMYSSWSF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|