C22H38N2O2 — CID 68555104
3-[(E)-oct-1-enyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 68555104) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 3-[(E)-oct-1-enyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(E)-oct-1-enyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 68555104 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 3-[(E)-oct-1-enyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCCC/C=C/C1CC(=O)N(C2CC(C)(C)N(C)C(C)(C)C2)C1=O |
| InChI | InChI=1S/C22H38N2O2/c1-7-8-9-10-11-12-13-17-14-19(25)24(20(17)26)18-15-21(2,3)23(6)22(4,5)16-18/h12-13,17-18H,7-11,14-16H2,1-6H3/b13-12+ |
| InChIKey | WZCYBDHZJRNSNT-OUKQBFOZSA-N |
| XLogP | 4.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|