C16H24Cl3NO2S — CID 152762265
1-(trichloromethylsulfanyl)-3-undec-1-enylpyrrolidine-2,5-dione (PubChem CID 152762265) has the molecular formula C16H24Cl3NO2S and a molecular weight of 400.80 g/mol. Its IUPAC name is 1-(trichloromethylsulfanyl)-3-undec-1-enylpyrrolidine-2,5-dione.
| Compound Name | 1-(trichloromethylsulfanyl)-3-undec-1-enylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 152762265 |
| Molecular Formula | C16H24Cl3NO2S |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 1-(trichloromethylsulfanyl)-3-undec-1-enylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCC=CC1CC(=O)N(SC(Cl)(Cl)Cl)C1=O |
| InChI | InChI=1S/C16H24Cl3NO2S/c1-2-3-4-5-6-7-8-9-10-11-13-12-14(21)20(15(13)22)23-16(17,18)19/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | DNKCYZVXXBFPTQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|