C11H12F3N3O — CID 143400095
methyliminomethyl 2-[2-amino-4-(trifluoromethyl)phenyl]ethanimidate (PubChem CID 143400095) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is methyliminomethyl 2-[2-amino-4-(trifluoromethyl)phenyl]ethanimidate.
| Compound Name | methyliminomethyl 2-[2-amino-4-(trifluoromethyl)phenyl]ethanimidate |
|---|---|
| PubChem CID | 143400095 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | methyliminomethyl 2-[2-amino-4-(trifluoromethyl)phenyl]ethanimidate |
| SMILES | [H]/N=C(/Cc1ccc(C(F)(F)F)cc1N)O/C=N/C |
| InChI | InChI=1S/C11H12F3N3O/c1-17-6-18-10(16)4-7-2-3-8(5-9(7)15)11(12,13)14/h2-3,5-6,16H,4,15H2,1H3/b16-10-,17-6+ |
| InChIKey | SUNXKPZLYHLNKW-JPBXHXQBSA-N |
| XLogP | 2.48 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|