C17H20N4O3 — CID 143400351
2-[(2-aminoacetyl)amino]-N-(formamidomethyl)-3-naphthalen-1-ylpropanamide (PubChem CID 143400351) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-N-(formamidomethyl)-3-naphthalen-1-ylpropanamide.
| Compound Name | 2-[(2-aminoacetyl)amino]-N-(formamidomethyl)-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 143400351 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-N-(formamidomethyl)-3-naphthalen-1-ylpropanamide |
| SMILES | NCC(=O)NC(Cc1cccc2ccccc12)C(=O)NCNC=O |
| InChI | InChI=1S/C17H20N4O3/c18-9-16(23)21-15(17(24)20-10-19-11-22)8-13-6-3-5-12-4-1-2-7-14(12)13/h1-7,11,15H,8-10,18H2,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | YXFADLINVFCAMX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|