C24H27NO4 — CID 143401022
1-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]-3-methyl-2-(2-methylphenyl)but-2-en-1-one (PubChem CID 143401022) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]-3-methyl-2-(2-methylphenyl)but-2-en-1-one.
| Compound Name | 1-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]-3-methyl-2-(2-methylphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 143401022 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]-3-methyl-2-(2-methylphenyl)but-2-en-1-one |
| SMILES | CC(C)=C(C(=O)N1CCC(O)(c2ccc3c(c2)OCO3)CC1)c1ccccc1C |
| InChI | InChI=1S/C24H27NO4/c1-16(2)22(19-7-5-4-6-17(19)3)23(26)25-12-10-24(27,11-13-25)18-8-9-20-21(14-18)29-15-28-20/h4-9,14,27H,10-13,15H2,1-3H3 |
| InChIKey | WZYSVFDLBODUTC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|