C12H15N3 — CID 143402587
1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methyl-1,2,3-triazacyclohexa-2,4,5-triene (PubChem CID 143402587) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methyl-1,2,3-triazacyclohexa-2,4,5-triene.
| Compound Name | 1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methyl-1,2,3-triazacyclohexa-2,4,5-triene |
|---|---|
| PubChem CID | 143402587 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methyl-1,2,3-triazacyclohexa-2,4,5-triene |
| SMILES | C=C/C=C\C(=C/C)CN1C=C=C(C)N=N1 |
| InChI | InChI=1S/C12H15N3/c1-4-6-7-12(5-2)10-15-9-8-11(3)13-14-15/h4-7,9H,1,10H2,2-3H3/b7-6-,12-5+ |
| InChIKey | JJFWSLSMPNOVTE-BZNMCICSSA-N |
| XLogP | 3.37 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|