C23H32N4O3 — CID 143404316
1-(4-acetylphenyl)-4-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethyl]piperazin-2-one (PubChem CID 143404316) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-4-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethyl]piperazin-2-one.
| Compound Name | 1-(4-acetylphenyl)-4-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 143404316 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-(4-acetylphenyl)-4-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethyl]piperazin-2-one |
| SMILES | CC(=O)c1ccc(N2CCN(CC(=O)N3CCN(C4CCCC4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C23H32N4O3/c1-18(28)19-6-8-21(9-7-19)27-15-10-24(17-23(27)30)16-22(29)26-13-11-25(12-14-26)20-4-2-3-5-20/h6-9,20H,2-5,10-17H2,1H3 |
| InChIKey | HDEIBWPXIUTFGK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |