C28H50N4 — CID 143405363
(1E)-1-N-ethenyl-3-N,2-dimethyl-3-N-[(Z)-4-(methyliminomethyl)hex-4-enyl]-1-[(Z)-pentan-2-ylideneamino]-1-N-pentylhexa-1,3-diene-1,3-diamine (PubChem CID 143405363) has the molecular formula C28H50N4 and a molecular weight of 442.74 g/mol. Its IUPAC name is (1E)-1-N-ethenyl-3-N,2-dimethyl-3-N-[(Z)-4-(methyliminomethyl)hex-4-enyl]-1-[(Z)-pentan-2-ylideneamino]-1-N-pentylhexa-1,3-diene-1,3-diamine.
| Compound Name | (1E)-1-N-ethenyl-3-N,2-dimethyl-3-N-[(Z)-4-(methyliminomethyl)hex-4-enyl]-1-[(Z)-pentan-2-ylideneamino]-1-N-pentylhexa-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 143405363 |
| Molecular Formula | C28H50N4 |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 442.40 |
| IUPAC Name | (1E)-1-N-ethenyl-3-N,2-dimethyl-3-N-[(Z)-4-(methyliminomethyl)hex-4-enyl]-1-[(Z)-pentan-2-ylideneamino]-1-N-pentylhexa-1,3-diene-1,3-diamine |
| SMILES | C=CN(CCCCC)C(/N=C(/C)CCC)=C(/C)C(=CCC)N(C)CCCC(=C/C)/C=N/C |
| InChI | InChI=1S/C28H50N4/c1-10-15-16-22-32(14-5)28(30-24(6)18-11-2)25(7)27(19-12-3)31(9)21-17-20-26(13-4)23-29-8/h13-14,19,23H,5,10-12,15-18,20-22H2,1-4,6-9H3/b26-13-,27-19?,28-25-,29-23+,30-24- |
| InChIKey | RQLFXXKYDJYGFN-KUANCMAKSA-N |
| XLogP | 7.77 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|