C30H44N4 — CID 166834005
(2Z,4E)-4-ethyl-N-[(3Z,5Z)-5-ethyl-2-ethylidenehepta-3,5-dienyl]-2-[[3-methyl-2-[(E)-1-methyliminobut-2-en-2-yl]-2H-pyrimidin-4-yl]methyl]hexa-2,4-dien-1-imine (PubChem CID 166834005) has the molecular formula C30H44N4 and a molecular weight of 460.71 g/mol. Its IUPAC name is (2Z,4E)-4-ethyl-N-[(3Z,5Z)-5-ethyl-2-ethylidenehepta-3,5-dienyl]-2-[[3-methyl-2-[(E)-1-methyliminobut-2-en-2-yl]-2H-pyrimidin-4-yl]methyl]hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-4-ethyl-N-[(3Z,5Z)-5-ethyl-2-ethylidenehepta-3,5-dienyl]-2-[[3-methyl-2-[(E)-1-methyliminobut-2-en-2-yl]-2H-pyrimidin-4-yl]methyl]hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166834005 |
| Molecular Formula | C30H44N4 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | (2Z,4E)-4-ethyl-N-[(3Z,5Z)-5-ethyl-2-ethylidenehepta-3,5-dienyl]-2-[[3-methyl-2-[(E)-1-methyliminobut-2-en-2-yl]-2H-pyrimidin-4-yl]methyl]hexa-2,4-dien-1-imine |
| SMILES | CC=C(/C=C\C(=C/C)CC)C/N=C/C(=C\C(=C\C)CC)CC1=CC=NC(C(/C=N/C)=C/C)N1C |
| InChI | InChI=1S/C30H44N4/c1-9-24(10-2)15-16-26(13-5)21-32-22-27(19-25(11-3)12-4)20-29-17-18-33-30(34(29)8)28(14-6)23-31-7/h9,11,13-19,22-23,30H,10,12,20-21H2,1-8H3/b16-15-,24-9-,25-11+,26-13?,27-19-,28-14+,31-23+,32-22+ |
| InChIKey | JVAHRPNWJIWWEN-UPCPHCQLSA-N |
| XLogP | 7.46 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|