C14H22N4O2S — CID 143406193
(2S)-N-(cyclopropylmethyl)-2-[[(2S)-2-formamido-3-(1,3-thiazol-4-yl)propyl]amino]propanamide (PubChem CID 143406193) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (2S)-N-(cyclopropylmethyl)-2-[[(2S)-2-formamido-3-(1,3-thiazol-4-yl)propyl]amino]propanamide.
| Compound Name | (2S)-N-(cyclopropylmethyl)-2-[[(2S)-2-formamido-3-(1,3-thiazol-4-yl)propyl]amino]propanamide |
|---|---|
| PubChem CID | 143406193 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S)-N-(cyclopropylmethyl)-2-[[(2S)-2-formamido-3-(1,3-thiazol-4-yl)propyl]amino]propanamide |
| SMILES | C[C@H](NC[C@H](Cc1cscn1)NC=O)C(=O)NCC1CC1 |
| InChI | InChI=1S/C14H22N4O2S/c1-10(14(20)16-5-11-2-3-11)15-6-12(17-8-19)4-13-7-21-9-18-13/h7-12,15H,2-6H2,1H3,(H,16,20)(H,17,19)/t10-,12-/m0/s1 |
| InChIKey | IPICIWDOAKLYDT-JQWIXIFHSA-N |
| XLogP | 0.30 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|