C9H15N3OS — CID 174863680
4-(cyclobutylmethyl)-1,3-thiazole;formohydrazide (PubChem CID 174863680) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-(cyclobutylmethyl)-1,3-thiazole;formohydrazide.
| Compound Name | 4-(cyclobutylmethyl)-1,3-thiazole;formohydrazide |
|---|---|
| PubChem CID | 174863680 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-(cyclobutylmethyl)-1,3-thiazole;formohydrazide |
| SMILES | NNC=O.c1nc(CC2CCC2)cs1 |
| InChI | InChI=1S/C8H11NS.CH4N2O/c1-2-7(3-1)4-8-5-10-6-9-8;2-3-1-4/h5-7H,1-4H2;1H,2H2,(H,3,4) |
| InChIKey | XKDJTHBABXXTDN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|