C14H24N2O — CID 143407588
(2E,4Z)-4-[2-(1,4-oxazepan-4-yl)ethyl]hepta-2,4,6-trien-2-amine (PubChem CID 143407588) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2E,4Z)-4-[2-(1,4-oxazepan-4-yl)ethyl]hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-4-[2-(1,4-oxazepan-4-yl)ethyl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143407588 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2E,4Z)-4-[2-(1,4-oxazepan-4-yl)ethyl]hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C(\C=C(/C)N)CCN1CCCOCC1 |
| InChI | InChI=1S/C14H24N2O/c1-3-5-14(12-13(2)15)6-8-16-7-4-10-17-11-9-16/h3,5,12H,1,4,6-11,15H2,2H3/b13-12+,14-5- |
| InChIKey | CWEMSDMGEQBDPS-FAZSIYGLSA-N |
| XLogP | 2.07 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|