C16H26N4 — CID 143408131
ethane;(3Z)-5-[(4E)-5-methylidene-4-[(Z)-pent-3-enylidene]-1H-imidazol-2-yl]penta-1,3-diene-1,1-diamine (PubChem CID 143408131) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is ethane;(3Z)-5-[(4E)-5-methylidene-4-[(Z)-pent-3-enylidene]-1H-imidazol-2-yl]penta-1,3-diene-1,1-diamine.
| Compound Name | ethane;(3Z)-5-[(4E)-5-methylidene-4-[(Z)-pent-3-enylidene]-1H-imidazol-2-yl]penta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 143408131 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | ethane;(3Z)-5-[(4E)-5-methylidene-4-[(Z)-pent-3-enylidene]-1H-imidazol-2-yl]penta-1,3-diene-1,1-diamine |
| SMILES | C=c1[nH]c(C/C=C\C=C(N)N)n/c1=C/C/C=C\C.CC |
| InChI | InChI=1S/C14H20N4.C2H6/c1-3-4-5-8-12-11(2)17-14(18-12)10-7-6-9-13(15)16;1-2/h3-4,6-9H,2,5,10,15-16H2,1H3,(H,17,18);1-2H3/b4-3-,7-6-,12-8+; |
| InChIKey | AFSHZXLFYPQMKG-KYSBDNLCSA-N |
| XLogP | 1.45 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|