C14H14N2S — CID 143408218
2-[(1E,6Z)-cycloocta-1,6-dien-1-yl]-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 143408218) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-[(1E,6Z)-cycloocta-1,6-dien-1-yl]-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-[(1E,6Z)-cycloocta-1,6-dien-1-yl]-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 143408218 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[(1E,6Z)-cycloocta-1,6-dien-1-yl]-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | C1=C\C/C(c2nc3ccncc3s2)=C\CCC/1 |
| InChI | InChI=1S/C14H14N2S/c1-2-4-6-11(7-5-3-1)14-16-12-8-9-15-10-13(12)17-14/h2,4,7-10H,1,3,5-6H2/b4-2-,11-7+ |
| InChIKey | WBWIVQQKFLBSAW-NJLXZEHQSA-N |
| XLogP | 4.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|