C21H21N3O4 — CID 143408520
N-[4-[(3-amino-4-pyridinyl)oxymethyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 143408520) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[4-[(3-amino-4-pyridinyl)oxymethyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[(3-amino-4-pyridinyl)oxymethyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 143408520 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[4-[(3-amino-4-pyridinyl)oxymethyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(COc3ccncc3N)cc2)cc1OC |
| InChI | InChI=1S/C21H21N3O4/c1-26-19-8-5-15(11-20(19)27-2)21(25)24-16-6-3-14(4-7-16)13-28-18-9-10-23-12-17(18)22/h3-12H,13,22H2,1-2H3,(H,24,25) |
| InChIKey | ZZQXIFPYZRNGSI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |