C28H34N4O4S — CID 143409798
3,4-dimethoxy-N-[6-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]cyclohepta-1,3,5-trien-1-yl]benzamide;ethane (PubChem CID 143409798) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[6-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]cyclohepta-1,3,5-trien-1-yl]benzamide;ethane.
| Compound Name | 3,4-dimethoxy-N-[6-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]cyclohepta-1,3,5-trien-1-yl]benzamide;ethane |
|---|---|
| PubChem CID | 143409798 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 3,4-dimethoxy-N-[6-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]cyclohepta-1,3,5-trien-1-yl]benzamide;ethane |
| SMILES | CC.COc1ccc(C(=O)NC2=CC=CC=C(c3cn4c(CN5CCOCC5)csc4n3)C2)cc1OC |
| InChI | InChI=1S/C26H28N4O4S.C2H6/c1-32-23-8-7-19(14-24(23)33-2)25(31)27-20-6-4-3-5-18(13-20)22-16-30-21(17-35-26(30)28-22)15-29-9-11-34-12-10-29;1-2/h3-8,14,16-17H,9-13,15H2,1-2H3,(H,27,31);1-2H3 |
| InChIKey | FDNCEVRQQRXGIL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |