C17H16ClN3O2 — CID 143410085
3-(chloromethyl)-2-(2-nitro-4-propylphenyl)imidazo[1,2-a]pyridine (PubChem CID 143410085) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2-nitro-4-propylphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(chloromethyl)-2-(2-nitro-4-propylphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 143410085 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-(chloromethyl)-2-(2-nitro-4-propylphenyl)imidazo[1,2-a]pyridine |
| SMILES | CCCc1ccc(-c2nc3ccccn3c2CCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16ClN3O2/c1-2-5-12-7-8-13(14(10-12)21(22)23)17-15(11-18)20-9-4-3-6-16(20)19-17/h3-4,6-10H,2,5,11H2,1H3 |
| InChIKey | BDBTUPAXWADWQD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|