C12H16ClNO4 — CID 143411383
methyl 2-[[(3Z,5E)-6-chloroocta-3,5,7-trienoyl]amino]-3-hydroxypropanoate (PubChem CID 143411383) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is methyl 2-[[(3Z,5E)-6-chloroocta-3,5,7-trienoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[(3Z,5E)-6-chloroocta-3,5,7-trienoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 143411383 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl 2-[[(3Z,5E)-6-chloroocta-3,5,7-trienoyl]amino]-3-hydroxypropanoate |
| SMILES | C=C/C(Cl)=C\C=C/CC(=O)NC(CO)C(=O)OC |
| InChI | InChI=1S/C12H16ClNO4/c1-3-9(13)6-4-5-7-11(16)14-10(8-15)12(17)18-2/h3-6,10,15H,1,7-8H2,2H3,(H,14,16)/b5-4-,9-6+ |
| InChIKey | COXMKATYUHVKSN-KMOPYBJPSA-N |
| XLogP | 0.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|