C26H36N4O2 — CID 143413042
(16E)-7,7-diethyl-13-methyl-5-(oxolan-2-ylmethyl)-5,11,14,15-tetrazatetracyclo[10.8.0.02,10.04,8]icosa-1(12),2,4(8),9,16-pentaen-6-one (PubChem CID 143413042) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (16E)-7,7-diethyl-13-methyl-5-(oxolan-2-ylmethyl)-5,11,14,15-tetrazatetracyclo[10.8.0.02,10.04,8]icosa-1(12),2,4(8),9,16-pentaen-6-one.
| Compound Name | (16E)-7,7-diethyl-13-methyl-5-(oxolan-2-ylmethyl)-5,11,14,15-tetrazatetracyclo[10.8.0.02,10.04,8]icosa-1(12),2,4(8),9,16-pentaen-6-one |
|---|---|
| PubChem CID | 143413042 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (16E)-7,7-diethyl-13-methyl-5-(oxolan-2-ylmethyl)-5,11,14,15-tetrazatetracyclo[10.8.0.02,10.04,8]icosa-1(12),2,4(8),9,16-pentaen-6-one |
| SMILES | CCC1(CC)C(=O)N(CC2CCCO2)c2cc3c4c([nH]c3cc21)C(C)NN/C=C/CCC4 |
| InChI | InChI=1S/C26H36N4O2/c1-4-26(5-2)21-15-22-20(14-23(21)30(25(26)31)16-18-10-9-13-32-18)19-11-7-6-8-12-27-29-17(3)24(19)28-22/h8,12,14-15,17-18,27-29H,4-7,9-11,13,16H2,1-3H3/b12-8+ |
| InChIKey | PNTXWYHWUZOSCP-XYOKQWHBSA-N |
| XLogP | 4.76 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|