About 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide
1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide (PubChem CID 91938345) has the molecular formula C18H26N2O4S
and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide |
| PubChem CID | 91938345 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide |
| SMILES | CCN1C(=O)CC(C)(C)c2cc(S(=O)(=O)NCC3CCCO3)ccc21 |
| InChI | InChI=1S/C18H26N2O4S/c1-4-20-16-8-7-14(10-15(16)18(2,3)11-17(20)21)25(22,23)19-12-13-6-5-9-24-13/h7-8,10,13,19H,4-6,9,11-12H2,1-3H3 |
| InChIKey | DQCIXGWBAQMBNG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide?
The IUPAC name of 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide (CID 91938345) is 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide.
What is the SMILES notation for 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide?
The canonical SMILES for 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide is CCN1C(=O)CC(C)(C)c2cc(S(=O)(=O)NCC3CCCO3)ccc21.
What is the InChIKey of 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide?
The InChIKey is DQCIXGWBAQMBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O4S/c1-4-20-16-8-7-14(10-15(16)18(2,3)11-17(20)21)25(22,23)19-12-13-6-5-9-24-13/h7-8,10,13,19H,4-6,9,11-12H2,1-3H3.
What are the key properties of 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide?
1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide has a molecular weight of 366.48 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,4-dimethyl-2-oxo-N-(oxolan-2-ylmethyl)-3H-quinoline-6-sulfonamide is sourced from PubChem (CID 91938345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).