About 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane
1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane (PubChem CID 143413766) has the molecular formula C10H13Cl
and a molecular weight of 168.67 g/mol. Its IUPAC name is 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane.
Analyze 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane?
The IUPAC name of 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane (CID 143413766) is 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane.
What is the SMILES notation for 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane?
The canonical SMILES for 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane is CC.CC1=CC(Cl)=C=CC=C1.
What is the InChIKey of 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane?
The InChIKey is RLXUSOQOUGTPBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl.C2H6/c1-7-4-2-3-5-8(9)6-7;1-2/h2-4,6H,1H3;1-2H3.
What are the key properties of 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane?
1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane has a molecular weight of 168.67 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-6-methylcyclohepta-1,2,4,6-tetraene;ethane is sourced from PubChem (CID 143413766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).