C14H7N2O7S- — CID 143413973
9-carboxy-5-sulfo-1,10-phenanthroline-2-carboxylate (PubChem CID 143413973) has the molecular formula C14H7N2O7S- and a molecular weight of 347.28 g/mol. Its IUPAC name is 9-carboxy-5-sulfo-1,10-phenanthroline-2-carboxylate.
| Compound Name | 9-carboxy-5-sulfo-1,10-phenanthroline-2-carboxylate |
|---|---|
| PubChem CID | 143413973 |
| Molecular Formula | C14H7N2O7S- |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 9-carboxy-5-sulfo-1,10-phenanthroline-2-carboxylate |
| SMILES | O=C([O-])c1ccc2c(S(=O)(=O)O)cc3ccc(C(=O)O)nc3c2n1 |
| InChI | InChI=1S/C14H8N2O7S/c17-13(18)8-3-1-6-5-10(24(21,22)23)7-2-4-9(14(19)20)16-12(7)11(6)15-8/h1-5H,(H,17,18)(H,19,20)(H,21,22,23)/p-1 |
| InChIKey | WKUFPPAOAOPTOQ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|